Products 1041555-23-0
CAS 1041555-23-0 is the registry number for 5-(((2,6-Dichlorophenyl)methyl)amino)-1H-isoindole-1,3(2H)-dione. Offered by: TRC. Available pack sizes: 100mg.
5-[(2,6-dichlorophenyl)methylamino]isoindole-1,3-dione (CAS 1041555-23-0) is a chemical compound with the molecular formula C15H10Cl2N2O2 and a molecular weight of 321.2 g/mol. IUPAC name: 5-[(2,6-dichlorophenyl)methylamino]isoindole-1,3-dione. InChIKey: DLTOLYAULFGVQM-UHFFFAOYSA-N.
| Molecular formula | C15H10Cl2N2O2 |
|---|---|
| Molecular weight | 321.2 g/mol |
| IUPAC name | 5-[(2,6-dichlorophenyl)methylamino]isoindole-1,3-dione |
| InChIKey | DLTOLYAULFGVQM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)CNC2=CC3=C(C=C2)C(=O)NC3=O)Cl |
Computed by PubChem (NCBI)