CAS 1798004-39-3 is the registry number for 11,11-Dichloro oxcarbazepine. Offered by: Biosynth. Available pack sizes: 25mg, 50mg.
5,5-dichloro-6-oxobenzo[b][1]benzazepine-11-carboxamide (CAS 1798004-39-3) is a chemical compound with the molecular formula C15H10Cl2N2O2 and a molecular weight of 321.2 g/mol. IUPAC name: 5,5-dichloro-6-oxobenzo[b][1]benzazepine-11-carboxamide. InChIKey: PJCNKGXLGJJUKF-UHFFFAOYSA-N.
| Molecular formula | C15H10Cl2N2O2 |
|---|---|
| Molecular weight | 321.2 g/mol |
| IUPAC name | 5,5-dichloro-6-oxobenzo[b][1]benzazepine-11-carboxamide |
| InChIKey | PJCNKGXLGJJUKF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(C3=CC=CC=C3N2C(=O)N)(Cl)Cl |
Computed by PubChem (NCBI)