CAS 1164479-10-0 is the registry number for (3Z)-1-(2,6-Dichlorobenzyl)-1h-indole-2,3-dione 3-oxime, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-[(2,6-dichlorophenyl)methyl]-3-nitrosoindol-2-ol (CAS 1164479-10-0) is a chemical compound with the molecular formula C15H10Cl2N2O2 and a molecular weight of 321.2 g/mol. IUPAC name: 1-[(2,6-dichlorophenyl)methyl]-3-nitrosoindol-2-ol. InChIKey: RZBLUDCBHZNVQF-UHFFFAOYSA-N.
| Molecular formula | C15H10Cl2N2O2 |
|---|---|
| Molecular weight | 321.2 g/mol |
| IUPAC name | 1-[(2,6-dichlorophenyl)methyl]-3-nitrosoindol-2-ol |
| InChIKey | RZBLUDCBHZNVQF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(N2CC3=C(C=CC=C3Cl)Cl)O)N=O |
Computed by PubChem (NCBI)