CAS 293766-12-8 appears in our catalog under these names: 2-([(3,4-Dichlorophenyl)amino]methyl)-1h-isoindole-1,3(2h)-dione, 95%, 2-(((3,4-Dichlorophenyl)amino)methyl)isoindoline-1,3-dione, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-[(3,4-dichloroanilino)methyl]isoindole-1,3-dione (CAS 293766-12-8) is a chemical compound with the molecular formula C15H10Cl2N2O2 and a molecular weight of 321.2 g/mol. IUPAC name: 2-[(3,4-dichloroanilino)methyl]isoindole-1,3-dione. InChIKey: GHFYXLZKGGGKBS-UHFFFAOYSA-N.
| Molecular formula | C15H10Cl2N2O2 |
|---|---|
| Molecular weight | 321.2 g/mol |
| IUPAC name | 2-[(3,4-dichloroanilino)methyl]isoindole-1,3-dione |
| InChIKey | GHFYXLZKGGGKBS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CNC3=CC(=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)