CAS 2955-37-5 appears in our catalog under these names: Lorazepam EP Impurity C, Delorazepam 4-Oxide (1mg/ml in Acetonitrile), Delorazepam 4-Oxide, >95% (HPLC), 7-Chloro-5-(2-chlorophenyl)-1,3-dihydro-2H-1,4-benzodiazepin-2-one 4-Oxide, 7-Chloro-5-(2-chloro-phenyl)-4-oxy-1,3-dihydro-benzo(e)(1,4)diazepin-2-one. Offered by: Chemat Brand, TRC, Mikromol, Biosynth. Available pack sizes: on request, 5x1ml, 100mg, 10mg, 25mg.
7-chloro-5-(2-chlorophenyl)-4-hydroxy-3H-1,4-benzodiazepin-2-one (CAS 2955-37-5) is a chemical compound with the molecular formula C15H10Cl2N2O2 and a molecular weight of 321.2 g/mol. IUPAC name: 7-chloro-5-(2-chlorophenyl)-4-hydroxy-3H-1,4-benzodiazepin-2-one. InChIKey: HIJLVSVTJNDDHT-UHFFFAOYSA-N.
| Molecular formula | C15H10Cl2N2O2 |
|---|---|
| Molecular weight | 321.2 g/mol |
| IUPAC name | 7-chloro-5-(2-chlorophenyl)-4-hydroxy-3H-1,4-benzodiazepin-2-one |
| InChIKey | HIJLVSVTJNDDHT-UHFFFAOYSA-N |
| SMILES | C1C(=O)N=C2C=CC(=CC2=C(N1O)C3=CC=CC=C3Cl)Cl |
Computed by PubChem (NCBI)