Products 91402-80-1
CAS 91402-80-1 is the registry number for (R)-Lorazepam. Offered by: Biosynth. Available pack sizes: 1mg, 2mg, 5mg.
(3R)-7-chloro-5-(2-chlorophenyl)-3-hydroxy-1,3-dihydro-1,4-benzodiazepin-2-one (CAS 91402-80-1) is a chemical compound with the molecular formula C15H10Cl2N2O2 and a molecular weight of 321.2 g/mol. IUPAC name: (3R)-7-chloro-5-(2-chlorophenyl)-3-hydroxy-1,3-dihydro-1,4-benzodiazepin-2-one. InChIKey: DIWRORZWFLOCLC-OAHLLOKOSA-N.
| Molecular formula | C15H10Cl2N2O2 |
|---|---|
| Molecular weight | 321.2 g/mol |
| IUPAC name | (3R)-7-chloro-5-(2-chlorophenyl)-3-hydroxy-1,3-dihydro-1,4-benzodiazepin-2-one |
| InChIKey | DIWRORZWFLOCLC-OAHLLOKOSA-N |
| SMILES | C1=CC=C(C(=C1)C2=N[C@@H](C(=O)NC3=C2C=C(C=C3)Cl)O)Cl |
Computed by PubChem (NCBI)