CAS 4780-17-0 is the registry number for beta-D-Glucopyranose-1,3,4,6-tetraacetate Isocyanic Acid. Offered by: TRC. Available pack sizes: 250mg.
3-[(2,4-dichlorophenoxy)methyl]-5-phenyl-1,2,4-oxadiazole (CAS 4780-17-0) is a chemical compound with the molecular formula C15H10Cl2N2O2 and a molecular weight of 321.2 g/mol. IUPAC name: 3-[(2,4-dichlorophenoxy)methyl]-5-phenyl-1,2,4-oxadiazole. InChIKey: WNSSFXONYAHSDF-UHFFFAOYSA-N.
| Molecular formula | C15H10Cl2N2O2 |
|---|---|
| Molecular weight | 321.2 g/mol |
| IUPAC name | 3-[(2,4-dichlorophenoxy)methyl]-5-phenyl-1,2,4-oxadiazole |
| InChIKey | WNSSFXONYAHSDF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NO2)COC3=C(C=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)