CAS 907200-04-8 is the registry number for Lorazepam-13C2,15N. Offered by: TRC. Available pack sizes: 25mg.
7-chloro-5-(2-chlorophenyl)-3-hydroxy-1,3-dihydro-1,4-benzodiazepin-2-one (CAS 907200-04-8) is a chemical compound with the molecular formula C15H10Cl2N2O2 and a molecular weight of 324.13 g/mol. IUPAC name: 7-chloro-5-(2-chlorophenyl)-3-hydroxy-1,3-dihydro-1,4-benzodiazepin-2-one. InChIKey: DIWRORZWFLOCLC-XPGGNPKHSA-N.
| Molecular formula | C15H10Cl2N2O2 |
|---|---|
| Molecular weight | 324.13 g/mol |
| IUPAC name | 7-chloro-5-(2-chlorophenyl)-3-hydroxy-1,3-dihydro-1,4-benzodiazepin-2-one |
| InChIKey | DIWRORZWFLOCLC-XPGGNPKHSA-N |
| SMILES | C1=CC=C(C(=C1)C2=[15N][13CH]([13C](=O)NC3=C2C=C(C=C3)Cl)O)Cl |
Computed by PubChem (NCBI)