CAS 104321-63-3 is the registry number for Ethyl (r)-cis-3-(2,2-dimethyl-1,3-dioxolan-4-yl)propenoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Ethyl (Z)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate (CAS 104321-63-3) is a chemical compound with the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. IUPAC name: ethyl (Z)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate. InChIKey: GZVXALXOWVXZLH-RPSMYOMKSA-N.
| Molecular formula | C10H16O4 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | ethyl (Z)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate |
| InChIKey | GZVXALXOWVXZLH-RPSMYOMKSA-N |
| SMILES | CCOC(=O)/C=C\[C@@H]1COC(O1)(C)C |
Computed by PubChem (NCBI)