CAS 91926-90-8 appears in our catalog under these names: (Z)-Ethyl-4,5-o-isopropylidene-(s)-4,5-dihydroxy-2-pentenoate, 95%, (S,Z)-Ethyl 3-(2,2-dimethyl-1,3-dioxolan-4-yl)acrylate, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 25g, 1g, 5g.
Ethyl (Z)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate (CAS 91926-90-8) is a chemical compound with the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. IUPAC name: ethyl (Z)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate. InChIKey: GZVXALXOWVXZLH-SLGIHZDVSA-N.
| Molecular formula | C10H16O4 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | ethyl (Z)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate |
| InChIKey | GZVXALXOWVXZLH-SLGIHZDVSA-N |
| SMILES | CCOC(=O)/C=C\[C@H]1COC(O1)(C)C |
Computed by PubChem (NCBI)