CAS 64520-58-7 appears in our catalog under these names: ETHYL (S)-(+)-3-(2,2-DIMETHYL-1,3-DIOXO&, (S,E)-Ethyl 3-(2,2-dimethyl-1,3-dioxolan-4-yl)acrylate, 99%(GC-MS),RG, 99%(GC-MS),RG. Offered by: Sigma-Aldrich, Chemat. Available pack sizes: 5G, 100mg, 250mg, 1g.
Ethyl (E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate (CAS 64520-58-7) is a chemical compound with the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. IUPAC name: ethyl (E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate. InChIKey: GZVXALXOWVXZLH-GJIOHYHPSA-N.
| Molecular formula | C10H16O4 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | ethyl (E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate |
| InChIKey | GZVXALXOWVXZLH-GJIOHYHPSA-N |
| SMILES | CCOC(=O)/C=C/[C@H]1COC(O1)(C)C |
Computed by PubChem (NCBI)