CAS 104517-25-1 is the registry number for 4-Bromo-7-hydroxy-3-methyl-2,3-dihydro-1H-inden-1-one, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-bromo-7-hydroxy-3-methyl-2,3-dihydroinden-1-one (CAS 104517-25-1) is a chemical compound with the molecular formula C10H9BrO2 and a molecular weight of 241.08 g/mol. IUPAC name: 4-bromo-7-hydroxy-3-methyl-2,3-dihydroinden-1-one. InChIKey: PZKXRNOZMKHSEB-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO2 |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | 4-bromo-7-hydroxy-3-methyl-2,3-dihydroinden-1-one |
| InChIKey | PZKXRNOZMKHSEB-UHFFFAOYSA-N |
| SMILES | CC1CC(=O)C2=C(C=CC(=C12)Br)O |
Computed by PubChem (NCBI)