Products 104866-53-7
CAS 104866-53-7 appears in our catalog under these names: 1，8–Naphthyridine–3–carboxylic acid, 1,8-Naphthyridine-3-carboxylic acid, 1,8-Naphthyridine-3-carboxylic acid 95%, 1,8-Naphthyridine-3-carboxylic acid, 95%, 95%, 1,8-Naphthyridine-3-carboxylic acid, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 0,5g, 0,25g, 1g, 50mg, 500mg.
1,8-naphthyridine-3-carboxylic acid (CAS 104866-53-7) is a chemical compound with the molecular formula C9H6N2O2 and a molecular weight of 174.16 g/mol. IUPAC name: 1,8-naphthyridine-3-carboxylic acid. InChIKey: CGXLVFZJJOXEDF-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O2 |
|---|---|
| Molecular weight | 174.16 g/mol |
| IUPAC name | 1,8-naphthyridine-3-carboxylic acid |
| InChIKey | CGXLVFZJJOXEDF-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CN=C2N=C1)C(=O)O |
Computed by PubChem (NCBI)