Products 1048919-23-8
CAS 1048919-23-8 is the registry number for 2-Phenoxy-1,3-oxazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-phenoxy-1,3-oxazole-4-carboxylic acid (CAS 1048919-23-8) is a chemical compound with the molecular formula C10H7NO4 and a molecular weight of 205.17 g/mol. IUPAC name: 2-phenoxy-1,3-oxazole-4-carboxylic acid. InChIKey: MSLQXSBLPAZCKR-UHFFFAOYSA-N.
| Molecular formula | C10H7NO4 |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | 2-phenoxy-1,3-oxazole-4-carboxylic acid |
| InChIKey | MSLQXSBLPAZCKR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=NC(=CO2)C(=O)O |
Computed by PubChem (NCBI)