CAS 1261925-44-3 is the registry number for 2-Formyl-5-(4-methylthiophenyl)phenol, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-hydroxy-4-(4-methylsulfanylphenyl)benzaldehyde (CAS 1261925-44-3) is a chemical compound with the molecular formula C14H12O2S and a molecular weight of 244.31 g/mol. IUPAC name: 2-hydroxy-4-(4-methylsulfanylphenyl)benzaldehyde. InChIKey: UOFAWYROSONALA-UHFFFAOYSA-N.
| Molecular formula | C14H12O2S |
|---|---|
| Molecular weight | 244.31 g/mol |
| IUPAC name | 2-hydroxy-4-(4-methylsulfanylphenyl)benzaldehyde |
| InChIKey | UOFAWYROSONALA-UHFFFAOYSA-N |
| SMILES | CSC1=CC=C(C=C1)C2=CC(=C(C=C2)C=O)O |
Computed by PubChem (NCBI)