CAS 1049026-36-9 appears in our catalog under these names: 3-Bromo-5-chlorobenzenesulfonyl chloride, 95%, 3-Bromo-5-chlorobenzenesulfonyl chloride, 3-Bromo-5-chlorobenzenesulfonyl chloride, 98%. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 1g, 5g, 10g, 2g, 250mg, 25g.
3-bromo-5-chlorobenzenesulfonyl chloride (CAS 1049026-36-9) is a chemical compound with the molecular formula C6H3BrCl2O2S and a molecular weight of 289.96 g/mol. IUPAC name: 3-bromo-5-chlorobenzenesulfonyl chloride. InChIKey: TVNXVTHWGFPUFR-UHFFFAOYSA-N.
| Molecular formula | C6H3BrCl2O2S |
|---|---|
| Molecular weight | 289.96 g/mol |
| IUPAC name | 3-bromo-5-chlorobenzenesulfonyl chloride |
| InChIKey | TVNXVTHWGFPUFR-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Br)S(=O)(=O)Cl |
Computed by PubChem (NCBI)