CAS 351003-52-6 appears in our catalog under these names: 4-Bromo-2-chlorobenzenesulfonyl chloride, 98%, 4–Bromo–2–chlorobenzenesulfonyl chloride, 4-Bromo-2-chlorobenzenesulfonyl chloride, 96% , 4-Bromo-2-chlorobenzenesulfonyl chloride, 96%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Fluorochem. Available pack sizes: 25g, 100g, 1g, 5g, 500g.
4-bromo-2-chlorobenzenesulfonyl chloride (CAS 351003-52-6) is a chemical compound with the molecular formula C6H3BrCl2O2S and a molecular weight of 289.96 g/mol. IUPAC name: 4-bromo-2-chlorobenzenesulfonyl chloride. InChIKey: OECYEHWJPRPCOH-UHFFFAOYSA-N.
| Molecular formula | C6H3BrCl2O2S |
|---|---|
| Molecular weight | 289.96 g/mol |
| IUPAC name | 4-bromo-2-chlorobenzenesulfonyl chloride |
| InChIKey | OECYEHWJPRPCOH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)