CAS 874801-46-4 is the registry number for 4-Bromo-3-chlorobenzenesulfonyl chloride, 97%. Offered by: Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g.
4-bromo-3-chlorobenzenesulfonyl chloride (CAS 874801-46-4) is a chemical compound with the molecular formula C6H3BrCl2O2S and a molecular weight of 289.96 g/mol. IUPAC name: 4-bromo-3-chlorobenzenesulfonyl chloride. InChIKey: FSNCFUWFJZQPTR-UHFFFAOYSA-N.
| Molecular formula | C6H3BrCl2O2S |
|---|---|
| Molecular weight | 289.96 g/mol |
| IUPAC name | 4-bromo-3-chlorobenzenesulfonyl chloride |
| InChIKey | FSNCFUWFJZQPTR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)Cl)Cl)Br |
Computed by PubChem (NCBI)