CAS 81226-68-8 appears in our catalog under these names: 5-Bromo-2-chlorobenzene-1-sulfonyl chloride, 95%, 5-Bromo-2-chlorobenzenesulfonyl chloride, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 100g, 25g, 10g, 1g, 250mg.
5-bromo-2-chlorobenzenesulfonyl chloride (CAS 81226-68-8) is a chemical compound with the molecular formula C6H3BrCl2O2S and a molecular weight of 289.96 g/mol. IUPAC name: 5-bromo-2-chlorobenzenesulfonyl chloride. InChIKey: QWVGJTXXYAIKIB-UHFFFAOYSA-N.
| Molecular formula | C6H3BrCl2O2S |
|---|---|
| Molecular weight | 289.96 g/mol |
| IUPAC name | 5-bromo-2-chlorobenzenesulfonyl chloride |
| InChIKey | QWVGJTXXYAIKIB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)