Products 1261646-81-4
CAS 1261646-81-4 is the registry number for 2-Bromo-3-chlorobenzene-1-sulfonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
2-bromo-3-chlorobenzenesulfonyl chloride (CAS 1261646-81-4) is a chemical compound with the molecular formula C6H3BrCl2O2S and a molecular weight of 289.96 g/mol. IUPAC name: 2-bromo-3-chlorobenzenesulfonyl chloride. InChIKey: LYBRJVPRDVGFLN-UHFFFAOYSA-N.
| Molecular formula | C6H3BrCl2O2S |
|---|---|
| Molecular weight | 289.96 g/mol |
| IUPAC name | 2-bromo-3-chlorobenzenesulfonyl chloride |
| InChIKey | LYBRJVPRDVGFLN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Br)S(=O)(=O)Cl |
Computed by PubChem (NCBI)