Products 195201-10-6

CAS 195201-10-6 appears in our catalog under these names: 3-Bromo-4-chlorobenzene-1-sulfonyl chloride, 95%, 3-Bromo-4-chlorobenzenesulfonyl chloride, 3-Bromo-4-chlorobenzenesulfonyl chloride, 95%. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.

Structural formula: {0} (CAS {1})

3-bromo-4-chlorobenzenesulfonyl chloride (CAS 195201-10-6) is a chemical compound with the molecular formula C6H3BrCl2O2S and a molecular weight of 289.96 g/mol. IUPAC name: 3-bromo-4-chlorobenzenesulfonyl chloride. InChIKey: WAKUMWHMHLMVPK-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3BrCl2O2S
Molecular weight289.96 g/mol
IUPAC name3-bromo-4-chlorobenzenesulfonyl chloride
InChIKeyWAKUMWHMHLMVPK-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1S(=O)(=O)Cl)Br)Cl

Computed by PubChem (NCBI)