Products 1261874-16-1
CAS 1261874-16-1 appears in our catalog under these names: 2-Bromo-6-chlorobenzene-1-sulfonyl chloride, 2-Bromo-6-chlorobenzene-1-sulfonyl chloride, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 250mg, 5g.
2-bromo-6-chlorobenzenesulfonyl chloride (CAS 1261874-16-1) is a chemical compound with the molecular formula C6H3BrCl2O2S and a molecular weight of 289.96 g/mol. IUPAC name: 2-bromo-6-chlorobenzenesulfonyl chloride. InChIKey: JLWJHDPRSPJELX-UHFFFAOYSA-N.
| Molecular formula | C6H3BrCl2O2S |
|---|---|
| Molecular weight | 289.96 g/mol |
| IUPAC name | 2-bromo-6-chlorobenzenesulfonyl chloride |
| InChIKey | JLWJHDPRSPJELX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)