Products 929281-63-0

CAS 929281-63-0 appears in our catalog under these names: 2-Bromo-4-chlorobenzenesulfonyl chloride, 95%, 2-Bromo-4-chlorobenzenesulfonyl chloride, 98%, 2-Bromo-4-chlorobenzenesulfonyl chloride, 2-Bromo-4-chlorobenzenesulfonyl chloride, 96%. Offered by: Combi-blocks, AmBeed, Biosynth, Fluorochem. Available pack sizes: 5g, 250mg, 100mg, 1g, 0,5g.

Structural formula: {0} (CAS {1})

2-bromo-4-chlorobenzenesulfonyl chloride (CAS 929281-63-0) is a chemical compound with the molecular formula C6H3BrCl2O2S and a molecular weight of 289.96 g/mol. IUPAC name: 2-bromo-4-chlorobenzenesulfonyl chloride. InChIKey: GGZAVOFHWRLKLS-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3BrCl2O2S
Molecular weight289.96 g/mol
IUPAC name2-bromo-4-chlorobenzenesulfonyl chloride
InChIKeyGGZAVOFHWRLKLS-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1Cl)Br)S(=O)(=O)Cl

Computed by PubChem (NCBI)