CAS 10495-62-2 is the registry number for 3-Phenyl-1h-1,2,4-triazol-5-amine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
5-phenyl-1H-1,2,4-triazol-3-amine;hydrochloride (CAS 10495-62-2) is a chemical compound with the molecular formula C8H9ClN4 and a molecular weight of 196.64 g/mol. IUPAC name: 5-phenyl-1H-1,2,4-triazol-3-amine;hydrochloride. InChIKey: GHDWCWCYOZPWHT-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN4 |
|---|---|
| Molecular weight | 196.64 g/mol |
| IUPAC name | 5-phenyl-1H-1,2,4-triazol-3-amine;hydrochloride |
| InChIKey | GHDWCWCYOZPWHT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NN2)N.Cl |
Computed by PubChem (NCBI)