CAS 1087712-11-5 appears in our catalog under these names: 4-(2H-1,2,3-Triazol-2-yl)aniline hydrochloride, 95%, 4-(2H-1,2,3-Triazol-2-yl)aniline hydrochloride, 95+%, BENZENAMINE, 4-(2H-1,2,3-TRIAZOL-2-YL)-, HCL. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 100mg, 250mg, 5g, 1g.
4-(triazol-2-yl)aniline;hydrochloride (CAS 1087712-11-5) is a chemical compound with the molecular formula C8H9ClN4 and a molecular weight of 196.64 g/mol. IUPAC name: 4-(triazol-2-yl)aniline;hydrochloride. InChIKey: FPDVWZUXTJFFMQ-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN4 |
|---|---|
| Molecular weight | 196.64 g/mol |
| IUPAC name | 4-(triazol-2-yl)aniline;hydrochloride |
| InChIKey | FPDVWZUXTJFFMQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)N2N=CC=N2.Cl |
Computed by PubChem (NCBI)