CAS 28565-42-6 appears in our catalog under these names: 7-Chloro-2-ethyl-5-methyl[1,2,4]triazolo[1,5-a]pyrimidine, 95%, 7-Chloro-2-ethyl-5-methyl-(1,2,4)triazolo(1,5-a)pyrimidine, 98%, 7-Chloro-2-ethyl-5-methyl[1,2,4]triazolo[1,5-a]pyrimidine, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
7-chloro-2-ethyl-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine (CAS 28565-42-6) is a chemical compound with the molecular formula C8H9ClN4 and a molecular weight of 196.64 g/mol. IUPAC name: 7-chloro-2-ethyl-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine. InChIKey: RAYACWRGKMUCCP-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN4 |
|---|---|
| Molecular weight | 196.64 g/mol |
| IUPAC name | 7-chloro-2-ethyl-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine |
| InChIKey | RAYACWRGKMUCCP-UHFFFAOYSA-N |
| SMILES | CCC1=NN2C(=CC(=NC2=N1)C)Cl |
Computed by PubChem (NCBI)