Products 1443289-75-5
CAS 1443289-75-5 appears in our catalog under these names: 6-Chloro-1-isopropyl-1h-pyrazolo[3,4-d]pyrimidine, 95%, 6-Chloro-1-isopropyl-1H-pyrazolo(3,4-d)pyrimidine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
6-chloro-1-propan-2-ylpyrazolo[3,4-d]pyrimidine (CAS 1443289-75-5) is a chemical compound with the molecular formula C8H9ClN4 and a molecular weight of 196.64 g/mol. IUPAC name: 6-chloro-1-propan-2-ylpyrazolo[3,4-d]pyrimidine. InChIKey: FHLSHPPSYMWMEV-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN4 |
|---|---|
| Molecular weight | 196.64 g/mol |
| IUPAC name | 6-chloro-1-propan-2-ylpyrazolo[3,4-d]pyrimidine |
| InChIKey | FHLSHPPSYMWMEV-UHFFFAOYSA-N |
| SMILES | CC(C)N1C2=NC(=NC=C2C=N1)Cl |
Computed by PubChem (NCBI)