CAS 55635-65-9 is the registry number for 2-Chloro-1,5,6-trimethyl-1H-imidazo[4,5-b]pyrazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-3,5,6-trimethylimidazo[4,5-b]pyrazine (CAS 55635-65-9) is a chemical compound with the molecular formula C8H9ClN4 and a molecular weight of 196.64 g/mol. IUPAC name: 2-chloro-3,5,6-trimethylimidazo[4,5-b]pyrazine. InChIKey: ORSLHNIKLWPXTL-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN4 |
|---|---|
| Molecular weight | 196.64 g/mol |
| IUPAC name | 2-chloro-3,5,6-trimethylimidazo[4,5-b]pyrazine |
| InChIKey | ORSLHNIKLWPXTL-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C2C(=N1)N=C(N2C)Cl)C |
Computed by PubChem (NCBI)