CAS 2282653-53-4 is the registry number for Tofacitinib Impurity 28. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-N,N-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine (CAS 2282653-53-4) is a chemical compound with the molecular formula C8H9ClN4 and a molecular weight of 196.64 g/mol. IUPAC name: 2-chloro-N,N-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine. InChIKey: WVYCWOYEBUYZPE-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN4 |
|---|---|
| Molecular weight | 196.64 g/mol |
| IUPAC name | 2-chloro-N,N-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| InChIKey | WVYCWOYEBUYZPE-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC(=NC2=C1C=CN2)Cl |
Computed by PubChem (NCBI)