CAS 72392-97-3 appears in our catalog under these names: 6-Chloro-3-(propan-2-yl)-[1,2,4]triazolo[4,3-b]pyridazine, 95%, 6-Chloro-3-isopropyl-(1,2,4)triazolo(4,3-b)pyridazine, 98+%, 6-Chloro-3-(1-methylethyl)-1,2,4-triazolo(4,3-b)pyridazine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 10g, 100mg.
6-chloro-3-propan-2-yl-[1,2,4]triazolo[4,3-b]pyridazine (CAS 72392-97-3) is a chemical compound with the molecular formula C8H9ClN4 and a molecular weight of 196.64 g/mol. IUPAC name: 6-chloro-3-propan-2-yl-[1,2,4]triazolo[4,3-b]pyridazine. InChIKey: SORYZUZFCWVNBT-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN4 |
|---|---|
| Molecular weight | 196.64 g/mol |
| IUPAC name | 6-chloro-3-propan-2-yl-[1,2,4]triazolo[4,3-b]pyridazine |
| InChIKey | SORYZUZFCWVNBT-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NN=C2N1N=C(C=C2)Cl |
Computed by PubChem (NCBI)