CAS 1071623-05-6 appears in our catalog under these names: 3-(Pyridin-3-yl)-1h-pyrazol-5-amine hydrochloride, 95%, 5-(Pyridin-3-yl)-1H-pyrazol-3-amine hydrochloride, 98%, 5-(Pyridin-3-yl)-1H-pyrazol-3-amine hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g.
5-pyridin-3-yl-1H-pyrazol-3-amine;hydrochloride (CAS 1071623-05-6) is a chemical compound with the molecular formula C8H9ClN4 and a molecular weight of 196.64 g/mol. IUPAC name: 5-pyridin-3-yl-1H-pyrazol-3-amine;hydrochloride. InChIKey: AXCMWLFDZDAQRY-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN4 |
|---|---|
| Molecular weight | 196.64 g/mol |
| IUPAC name | 5-pyridin-3-yl-1H-pyrazol-3-amine;hydrochloride |
| InChIKey | AXCMWLFDZDAQRY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=CC(=NN2)N.Cl |
Computed by PubChem (NCBI)