CAS 1049722-93-1 is the registry number for 2-(8-Chloro-2,3-dihydro-1,4-benzodioxin-6-yl)ethan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethanamine;hydrochloride (CAS 1049722-93-1) is a chemical compound with the molecular formula C10H13Cl2NO2 and a molecular weight of 250.12 g/mol. IUPAC name: 2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethanamine;hydrochloride. InChIKey: JOGDEGREPKXWLU-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl2NO2 |
|---|---|
| Molecular weight | 250.12 g/mol |
| IUPAC name | 2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethanamine;hydrochloride |
| InChIKey | JOGDEGREPKXWLU-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=C(C=C2Cl)CCN.Cl |
Computed by PubChem (NCBI)