CAS 1050909-73-3 appears in our catalog under these names: 5-(1-Chloroethyl)-3-(furan-2-yl)-1,2,4-oxadiazole, 95%, 5-(1-Chloroethyl)-3-(furan-2-yl)-1,2,4-oxadiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 250mg, 2,5g.
5-(1-chloroethyl)-3-(furan-2-yl)-1,2,4-oxadiazole (CAS 1050909-73-3) is a chemical compound with the molecular formula C8H7ClN2O2 and a molecular weight of 198.60 g/mol. IUPAC name: 5-(1-chloroethyl)-3-(furan-2-yl)-1,2,4-oxadiazole. InChIKey: POHJBSGNXADHRQ-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O2 |
|---|---|
| Molecular weight | 198.60 g/mol |
| IUPAC name | 5-(1-chloroethyl)-3-(furan-2-yl)-1,2,4-oxadiazole |
| InChIKey | POHJBSGNXADHRQ-UHFFFAOYSA-N |
| SMILES | CC(C1=NC(=NO1)C2=CC=CO2)Cl |
Computed by PubChem (NCBI)