Products 10510-77-7
CAS 10510-77-7 appears in our catalog under these names: Phenazine Ethosulfate, >95% (HPLC), Phenazine ethosulfate, Phenazine ethosulfate, 91.00%, PHENAZINE ETHOSULFATE, 97%, 97%, Phenazine ethosulfate, 99.85%. Offered by: TRC, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1g, 250mg, 500mg, 5g, 100mg, 50 mg, 100 mg, 25 mg.
5-ethylphenazin-5-ium;ethyl sulfate (CAS 10510-77-7) is a chemical compound with the molecular formula C16H18N2O4S and a molecular weight of 334.4 g/mol. IUPAC name: 5-ethylphenazin-5-ium;ethyl sulfate. InChIKey: VDJKJPMLWJWQIH-UHFFFAOYSA-M.
| Molecular formula | C16H18N2O4S |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | 5-ethylphenazin-5-ium;ethyl sulfate |
| InChIKey | VDJKJPMLWJWQIH-UHFFFAOYSA-M |
| SMILES | CC[N+]1=C2C=CC=CC2=NC3=CC=CC=C31.CCOS(=O)(=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
Phenazine ethosulfate, 5-Ethylphenazine, N-Ethylphenazonium ethosulfate, Phenazinium, 5-ethyl-, ethyl sulfate, 5-ethylphenazinium ethyl sulfate, N-ethyldibenzopyrazine ethyl sulfate, 5-ethylphenazinium ethyl sulfate salt, 5-ethylphenazin-5-ium ethyl sulfate, 5-Ethylphenazinium ethylsulfate, 5-ethylphenazin-5-ium;ethyl sulfate