Products 1051369-32-4
CAS 1051369-32-4 is the registry number for 3-(2-Aminoethoxy)benzoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
3-(2-aminoethoxy)benzoic acid;hydrochloride (CAS 1051369-32-4) is a chemical compound with the molecular formula C9H12ClNO3 and a molecular weight of 217.65 g/mol. IUPAC name: 3-(2-aminoethoxy)benzoic acid;hydrochloride. InChIKey: NVTCYLRHWIMKKG-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNO3 |
|---|---|
| Molecular weight | 217.65 g/mol |
| IUPAC name | 3-(2-aminoethoxy)benzoic acid;hydrochloride |
| InChIKey | NVTCYLRHWIMKKG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCCN)C(=O)O.Cl |
Computed by PubChem (NCBI)