CAS 105280-01-1 is the registry number for 1-(3-Ethynylphenyl)-1H-pyrrole-2,5-dione, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(3-ethynylphenyl)pyrrole-2,5-dione (CAS 105280-01-1) is a chemical compound with the molecular formula C12H7NO2 and a molecular weight of 197.19 g/mol. IUPAC name: 1-(3-ethynylphenyl)pyrrole-2,5-dione. InChIKey: ZZZLOLMQTUYXDM-UHFFFAOYSA-N.
| Molecular formula | C12H7NO2 |
|---|---|
| Molecular weight | 197.19 g/mol |
| IUPAC name | 1-(3-ethynylphenyl)pyrrole-2,5-dione |
| InChIKey | ZZZLOLMQTUYXDM-UHFFFAOYSA-N |
| SMILES | C#CC1=CC(=CC=C1)N2C(=O)C=CC2=O |
Computed by PubChem (NCBI)