CAS 5810-96-8 is the registry number for 1H-Benzo[f]indole-2,3-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1H-benzo[f]indole-2,3-dione (CAS 5810-96-8) is a chemical compound with the molecular formula C12H7NO2 and a molecular weight of 197.19 g/mol. IUPAC name: 1H-benzo[f]indole-2,3-dione. InChIKey: XHORCFOVPVATAY-UHFFFAOYSA-N.
| Molecular formula | C12H7NO2 |
|---|---|
| Molecular weight | 197.19 g/mol |
| IUPAC name | 1H-benzo[f]indole-2,3-dione |
| InChIKey | XHORCFOVPVATAY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C3C(=CC2=C1)C(=O)C(=O)N3 |
Computed by PubChem (NCBI)