CAS 299442-23-2 appears in our catalog under these names: 2-(5-formylfuran-2-yl)benzonitrile, 95%, 2-(5-Formyl-furan-2-yl)-benzonitrile, 95%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 25g, 1g.
2-(5-formylfuran-2-yl)benzonitrile (CAS 299442-23-2) is a chemical compound with the molecular formula C12H7NO2 and a molecular weight of 197.19 g/mol. IUPAC name: 2-(5-formylfuran-2-yl)benzonitrile. InChIKey: AXHWLBNYUIICMH-UHFFFAOYSA-N.
| Molecular formula | C12H7NO2 |
|---|---|
| Molecular weight | 197.19 g/mol |
| IUPAC name | 2-(5-formylfuran-2-yl)benzonitrile |
| InChIKey | AXHWLBNYUIICMH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C#N)C2=CC=C(O2)C=O |
Computed by PubChem (NCBI)