CAS 70377-05-8 is the registry number for 1H-Carbazole-1,4(9H)-dione. Offered by: TRC. Available pack sizes: 2,5g.
9H-carbazole-1,4-dione (CAS 70377-05-8) is a chemical compound with the molecular formula C12H7NO2 and a molecular weight of 197.19 g/mol. IUPAC name: 9H-carbazole-1,4-dione. InChIKey: OEYRAYKXZFYTQR-UHFFFAOYSA-N.
| Molecular formula | C12H7NO2 |
|---|---|
| Molecular weight | 197.19 g/mol |
| IUPAC name | 9H-carbazole-1,4-dione |
| InChIKey | OEYRAYKXZFYTQR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C(=O)C=CC3=O |
Computed by PubChem (NCBI)