CAS 81-83-4 appears in our catalog under these names: 1,8-Naphthalimide, 97%, 1,8–Naphthalimide, 1,8-Naphthalimide, 98% , 1,8-Naphthalimide 96%, 1,8-Naphthalimide, 96%, 96%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Chemat. Available pack sizes: 25g, 500g, 100g, 5g, 250g, 10g, 50g, 1x1000mg.
Benzo[de]isoquinoline-1,3-dione (CAS 81-83-4) is a chemical compound with the molecular formula C12H7NO2 and a molecular weight of 197.19 g/mol. IUPAC name: benzo[de]isoquinoline-1,3-dione. InChIKey: XJHABGPPCLHLLV-UHFFFAOYSA-N.
| Molecular formula | C12H7NO2 |
|---|---|
| Molecular weight | 197.19 g/mol |
| IUPAC name | benzo[de]isoquinoline-1,3-dione |
| InChIKey | XJHABGPPCLHLLV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C(=O)NC(=O)C3=CC=C2 |
Computed by PubChem (NCBI)