CAS 107401-98-9 is the registry number for Naphtho[2,3-d][1,3]dioxole-6-carbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Benzo[f][1,3]benzodioxole-6-carbonitrile (CAS 107401-98-9) is a chemical compound with the molecular formula C12H7NO2 and a molecular weight of 197.19 g/mol. IUPAC name: benzo[f][1,3]benzodioxole-6-carbonitrile. InChIKey: IKDFUPGVIMSEPZ-UHFFFAOYSA-N.
| Molecular formula | C12H7NO2 |
|---|---|
| Molecular weight | 197.19 g/mol |
| IUPAC name | benzo[f][1,3]benzodioxole-6-carbonitrile |
| InChIKey | IKDFUPGVIMSEPZ-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C3C=C(C=CC3=C2)C#N |
Computed by PubChem (NCBI)