CAS 65297-93-0 is the registry number for Chromeno[3,4-b]pyridin-5-one, 95%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 1g, 250mg, on request.
Chromeno[3,4-b]pyridin-5-one (CAS 65297-93-0) is a chemical compound with the molecular formula C12H7NO2 and a molecular weight of 197.19 g/mol. IUPAC name: chromeno[3,4-b]pyridin-5-one. InChIKey: CDNRMYZZOFXKBW-UHFFFAOYSA-N.
| Molecular formula | C12H7NO2 |
|---|---|
| Molecular weight | 197.19 g/mol |
| IUPAC name | chromeno[3,4-b]pyridin-5-one |
| InChIKey | CDNRMYZZOFXKBW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C(=O)O2)N=CC=C3 |
Computed by PubChem (NCBI)