Products 1416560-88-7

CAS 1416560-88-7 is the registry number for 7-Ethynylquinoline-3-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

7-ethynylquinoline-3-carboxylic acid (CAS 1416560-88-7) is a chemical compound with the molecular formula C12H7NO2 and a molecular weight of 197.19 g/mol. IUPAC name: 7-ethynylquinoline-3-carboxylic acid. InChIKey: SIIKZMHOWLIVBS-UHFFFAOYSA-N.

Identity
Molecular formulaC12H7NO2
Molecular weight197.19 g/mol
IUPAC name7-ethynylquinoline-3-carboxylic acid
InChIKeySIIKZMHOWLIVBS-UHFFFAOYSA-N
SMILESC#CC1=CC2=NC=C(C=C2C=C1)C(=O)O

Computed by PubChem (NCBI)