CAS 1059191-50-2 is the registry number for 7-Chloro-2-methyl-5-(methylthio)imidazo[1,2-c]pyrimidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-chloro-2-methyl-5-methylsulfanylimidazo[1,2-c]pyrimidine (CAS 1059191-50-2) is a chemical compound with the molecular formula C8H8ClN3S and a molecular weight of 213.69 g/mol. IUPAC name: 7-chloro-2-methyl-5-methylsulfanylimidazo[1,2-c]pyrimidine. InChIKey: UAMFPEUPEPPOKE-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN3S |
|---|---|
| Molecular weight | 213.69 g/mol |
| IUPAC name | 7-chloro-2-methyl-5-methylsulfanylimidazo[1,2-c]pyrimidine |
| InChIKey | UAMFPEUPEPPOKE-UHFFFAOYSA-N |
| SMILES | CC1=CN2C(=N1)C=C(N=C2SC)Cl |
Computed by PubChem (NCBI)