CAS 80945-76-2 is the registry number for Benzothiazole, 7-chloro-2-hydrazinyl-4-methyl-, 97%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
(7-chloro-4-methyl-1,3-benzothiazol-2-yl)hydrazine (CAS 80945-76-2) is a chemical compound with the molecular formula C8H8ClN3S and a molecular weight of 213.69 g/mol. IUPAC name: (7-chloro-4-methyl-1,3-benzothiazol-2-yl)hydrazine. InChIKey: XAIZTSNQCCWIKE-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN3S |
|---|---|
| Molecular weight | 213.69 g/mol |
| IUPAC name | (7-chloro-4-methyl-1,3-benzothiazol-2-yl)hydrazine |
| InChIKey | XAIZTSNQCCWIKE-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C(C=C1)Cl)SC(=N2)NN |
Computed by PubChem (NCBI)