CAS 5706-80-9 appears in our catalog under these names: 4-Chlorobenzaldehyde thiosemicarbazone, 4-Chlorobenzaldehyde thiosemicarbazone, 97%, 97%. Offered by: TRC, Chemat. Available pack sizes: 1g, 100mg, 250mg.
[(4-chlorophenyl)methylideneamino]thiourea (CAS 5706-80-9) is a chemical compound with the molecular formula C8H8ClN3S and a molecular weight of 213.69 g/mol. IUPAC name: [(4-chlorophenyl)methylideneamino]thiourea. InChIKey: FABQYDLGFZXBIK-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN3S |
|---|---|
| Molecular weight | 213.69 g/mol |
| IUPAC name | [(4-chlorophenyl)methylideneamino]thiourea |
| InChIKey | FABQYDLGFZXBIK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=NNC(=S)N)Cl |
Computed by PubChem (NCBI)