CAS 5706-79-6 is the registry number for 3-Chlorobenzaldehyde Thiosemicarbazone. Offered by: TRC. Available pack sizes: 1g.
[(E)-(3-chlorophenyl)methylideneamino]thiourea (CAS 5706-79-6) is a chemical compound with the molecular formula C8H8ClN3S and a molecular weight of 213.69 g/mol. IUPAC name: [(E)-(3-chlorophenyl)methylideneamino]thiourea. InChIKey: IPKPBBJJLUBSAV-VZUCSPMQSA-N.
| Molecular formula | C8H8ClN3S |
|---|---|
| Molecular weight | 213.69 g/mol |
| IUPAC name | [(E)-(3-chlorophenyl)methylideneamino]thiourea |
| InChIKey | IPKPBBJJLUBSAV-VZUCSPMQSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)/C=N/NC(=S)N |
Computed by PubChem (NCBI)