CAS 872696-07-6 is the registry number for 5-Chloro-2-hydrazino-4-methyl-1,3-benzothiazole, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 10g, 5g, 1g.
(5-chloro-4-methyl-1,3-benzothiazol-2-yl)hydrazine (CAS 872696-07-6) is a chemical compound with the molecular formula C8H8ClN3S and a molecular weight of 213.69 g/mol. IUPAC name: (5-chloro-4-methyl-1,3-benzothiazol-2-yl)hydrazine. InChIKey: QKNNCNAIIINUMQ-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN3S |
|---|---|
| Molecular weight | 213.69 g/mol |
| IUPAC name | (5-chloro-4-methyl-1,3-benzothiazol-2-yl)hydrazine |
| InChIKey | QKNNCNAIIINUMQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=C1N=C(S2)NN)Cl |
Computed by PubChem (NCBI)