CAS 80945-75-1 is the registry number for 2(3H)-Benzothiazolone, 6-chloro-4-methyl-, hydrazone. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
(6-chloro-4-methyl-1,3-benzothiazol-2-yl)hydrazine (CAS 80945-75-1) is a chemical compound with the molecular formula C8H8ClN3S and a molecular weight of 213.69 g/mol. IUPAC name: (6-chloro-4-methyl-1,3-benzothiazol-2-yl)hydrazine. InChIKey: CZVUVHRYOAEHAJ-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN3S |
|---|---|
| Molecular weight | 213.69 g/mol |
| IUPAC name | (6-chloro-4-methyl-1,3-benzothiazol-2-yl)hydrazine |
| InChIKey | CZVUVHRYOAEHAJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1N=C(S2)NN)Cl |
Computed by PubChem (NCBI)