CAS 5706-78-5 is the registry number for 2-Chlorobenzaldehyde thiosemicarbazone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.
[(E)-(2-chlorophenyl)methylideneamino]thiourea (CAS 5706-78-5) is a chemical compound with the molecular formula C8H8ClN3S and a molecular weight of 213.69 g/mol. IUPAC name: [(E)-(2-chlorophenyl)methylideneamino]thiourea. InChIKey: ZGPJVXICCFYSRT-VZUCSPMQSA-N.
| Molecular formula | C8H8ClN3S |
|---|---|
| Molecular weight | 213.69 g/mol |
| IUPAC name | [(E)-(2-chlorophenyl)methylideneamino]thiourea |
| InChIKey | ZGPJVXICCFYSRT-VZUCSPMQSA-N |
| SMILES | C1=CC=C(C(=C1)/C=N/NC(=S)N)Cl |
Computed by PubChem (NCBI)